Carboxylic acids and derivatives
Filtered Search Results
N,N-Dimethylbutyramide, 98%
CAS: 760-79-2 Molecular Formula: C6H13NO Molecular Weight (g/mol): 115.176 MDL Number: MFCD00015222 InChI Key: VIJUZNJJLALGNJ-UHFFFAOYSA-N Synonym: n,n-dimethylbutyramide,butanamide, n,n-dimethyl,n,n-dimethyl-n-butyramide,nn-dimethylbutyramide,butyramide, n,n-dimethyl,butanamide,n-dimethyl,butanamide,n,n-dimethyl,butanoic acid dimethylamide,nn-dimethylbutyramide, pract.,wln: 3vn1&1 PubChem CID: 12973 IUPAC Name: N,N-dimethylbutanamide SMILES: CCCC(=O)N(C)C
| PubChem CID | 12973 |
|---|---|
| CAS | 760-79-2 |
| Molecular Weight (g/mol) | 115.176 |
| MDL Number | MFCD00015222 |
| SMILES | CCCC(=O)N(C)C |
| Synonym | n,n-dimethylbutyramide,butanamide, n,n-dimethyl,n,n-dimethyl-n-butyramide,nn-dimethylbutyramide,butyramide, n,n-dimethyl,butanamide,n-dimethyl,butanamide,n,n-dimethyl,butanoic acid dimethylamide,nn-dimethylbutyramide, pract.,wln: 3vn1&1 |
| IUPAC Name | N,N-dimethylbutanamide |
| InChI Key | VIJUZNJJLALGNJ-UHFFFAOYSA-N |
| Molecular Formula | C6H13NO |
3-Mercaptopropionic acid, 98%
CAS: 107-96-0 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.14 MDL Number: MFCD00004897 InChI Key: DKIDEFUBRARXTE-UHFFFAOYSA-N Synonym: 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid PubChem CID: 6514 ChEBI: CHEBI:44111 IUPAC Name: 3-sulfanylpropanoic acid SMILES: C(CS)C(=O)O
| PubChem CID | 6514 |
|---|---|
| CAS | 107-96-0 |
| Molecular Weight (g/mol) | 106.14 |
| ChEBI | CHEBI:44111 |
| MDL Number | MFCD00004897 |
| SMILES | C(CS)C(=O)O |
| Synonym | 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid |
| IUPAC Name | 3-sulfanylpropanoic acid |
| InChI Key | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |
Dehydroacetic acid, 98%
CAS: 520-45-6 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.148 MDL Number: MFCD00066709 InChI Key: PGRHXDWITVMQBC-UHFFFAOYSA-N Synonym: dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 PubChem CID: 122903 IUPAC Name: 3-acetyl-6-methylpyran-2,4-dione SMILES: CC1=CC(=O)C(C(=O)O1)C(=O)C
| PubChem CID | 122903 |
|---|---|
| CAS | 520-45-6 |
| Molecular Weight (g/mol) | 168.148 |
| MDL Number | MFCD00066709 |
| SMILES | CC1=CC(=O)C(C(=O)O1)C(=O)C |
| Synonym | dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 |
| IUPAC Name | 3-acetyl-6-methylpyran-2,4-dione |
| InChI Key | PGRHXDWITVMQBC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
5-Norbornene-2-carboxylic acid, 98%, mixture of isomers, Thermo Scientific Chemicals
CAS: 120-74-1 Molecular Formula: C8H10O2 Molecular Weight (g/mol): 138.16 InChI Key: FYGUSUBEMUKACF-UHFFFAOYSA-N Synonym: 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid PubChem CID: 78949 IUPAC Name: bicyclo[2.2.1]hept-2-ene-5-carboxylic acid SMILES: C1C2CC(C1C=C2)C(=O)O
| PubChem CID | 78949 |
|---|---|
| CAS | 120-74-1 |
| Molecular Weight (g/mol) | 138.16 |
| SMILES | C1C2CC(C1C=C2)C(=O)O |
| Synonym | 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-5-carboxylic acid |
| InChI Key | FYGUSUBEMUKACF-UHFFFAOYSA-N |
| Molecular Formula | C8H10O2 |
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate, 97%, stab.
CAS: 13695-31-3 Molecular Formula: C8H7F7O2 Molecular Weight (g/mol): 268.131 MDL Number: MFCD00039251 InChI Key: VIEHKBXCWMMOOU-UHFFFAOYSA-N Synonym: heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # PubChem CID: 83666 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F
| PubChem CID | 83666 |
|---|---|
| CAS | 13695-31-3 |
| Molecular Weight (g/mol) | 268.131 |
| MDL Number | MFCD00039251 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
| Synonym | heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate |
| InChI Key | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
| Molecular Formula | C8H7F7O2 |
Methyl DL-lactate, 99%
CAS: 547-64-8 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.105 MDL Number: MFCD00066367 InChI Key: LPEKGGXMPWTOCB-UHFFFAOYSA-N Synonym: methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate PubChem CID: 11040 ChEBI: CHEBI:83221 IUPAC Name: methyl 2-hydroxypropanoate SMILES: CC(C(=O)OC)O
| PubChem CID | 11040 |
|---|---|
| CAS | 547-64-8 |
| Molecular Weight (g/mol) | 104.105 |
| ChEBI | CHEBI:83221 |
| MDL Number | MFCD00066367 |
| SMILES | CC(C(=O)OC)O |
| Synonym | methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate |
| IUPAC Name | methyl 2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Ethyl 2-methylbutyrate, 99%
CAS: 7452-79-1 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00012217 InChI Key: HCRBXQFHJMCTLF-UHFFFAOYSA-N Synonym: ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci PubChem CID: 24020 IUPAC Name: ethyl 2-methylbutanoate SMILES: CCC(C)C(=O)OCC
| PubChem CID | 24020 |
|---|---|
| CAS | 7452-79-1 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00012217 |
| SMILES | CCC(C)C(=O)OCC |
| Synonym | ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci |
| IUPAC Name | ethyl 2-methylbutanoate |
| InChI Key | HCRBXQFHJMCTLF-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Ethylenediaminetetraacetic acid zinc disodium salt hydrate
CAS: 14025-21-9 Molecular Formula: C10H12N2Na2O8Zn MDL Number: MFCD00135187 InChI Key: UBLOJEHIINPTTG-UHFFFAOYSA-J Synonym: zinc disodium edta,edta disodium zinc salt,unii-r84ov391ba,sequestrene na2zn zinc chelate,disodium zinc edetate,disodium zinc ethylenediaminetetraacetate,zinc disodium ethylenediaminetetraacetate,disodium zinc ethylenediaminetetraacetate dihydrate,acetic acid, ethylenedinitrilo tetra-, disodium salt, zinc complex, dihydrate,ethylenediaminetetraacetic acid disodium zinc salt PubChem CID: 51808 IUPAC Name: disodium;zinc;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate
| PubChem CID | 51808 |
|---|---|
| CAS | 14025-21-9 |
| MDL Number | MFCD00135187 |
| Synonym | zinc disodium edta,edta disodium zinc salt,unii-r84ov391ba,sequestrene na2zn zinc chelate,disodium zinc edetate,disodium zinc ethylenediaminetetraacetate,zinc disodium ethylenediaminetetraacetate,disodium zinc ethylenediaminetetraacetate dihydrate,acetic acid, ethylenedinitrilo tetra-, disodium salt, zinc complex, dihydrate,ethylenediaminetetraacetic acid disodium zinc salt |
| IUPAC Name | disodium;zinc;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| InChI Key | UBLOJEHIINPTTG-UHFFFAOYSA-J |
| Molecular Formula | C10H12N2Na2O8Zn |
N-(2-Bromoethyl)phthalimide, 97+%
CAS: 574-98-1 Molecular Formula: C10H8BrNO2 Molecular Weight (g/mol): 254.083 MDL Number: MFCD00005902 InChI Key: CHZXTOCAICMPQR-UHFFFAOYSA-N Synonym: n-2-bromoethyl phthalimide,2-2-bromoethyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-2-bromoethyl,2-2-bromoethyl-1h-isoindole-1,3 2h-dione,beta-bromoethylphthalimide,2-bromoethyl phthalimide,1-bromo-2-phthalimidoethane,beta-phthalimidoethyl bromide,n-2-bromoethyl-phthalimide,2-2-bromo-ethyl-isoindole-1,3-dione PubChem CID: 11325 IUPAC Name: 2-(2-bromoethyl)isoindole-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)N(C2=O)CCBr
| PubChem CID | 11325 |
|---|---|
| CAS | 574-98-1 |
| Molecular Weight (g/mol) | 254.083 |
| MDL Number | MFCD00005902 |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCBr |
| Synonym | n-2-bromoethyl phthalimide,2-2-bromoethyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-2-bromoethyl,2-2-bromoethyl-1h-isoindole-1,3 2h-dione,beta-bromoethylphthalimide,2-bromoethyl phthalimide,1-bromo-2-phthalimidoethane,beta-phthalimidoethyl bromide,n-2-bromoethyl-phthalimide,2-2-bromo-ethyl-isoindole-1,3-dione |
| IUPAC Name | 2-(2-bromoethyl)isoindole-1,3-dione |
| InChI Key | CHZXTOCAICMPQR-UHFFFAOYSA-N |
| Molecular Formula | C10H8BrNO2 |
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate, 98%, stab.
CAS: 355-93-1 Molecular Formula: C9H8F8O2 Molecular Weight (g/mol): 300.15 MDL Number: MFCD00039278 InChI Key: ZNJXRXXJPIFFAO-UHFFFAOYSA-N Synonym: 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate PubChem CID: 67739 IUPAC Name: 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F
| PubChem CID | 67739 |
|---|---|
| CAS | 355-93-1 |
| Molecular Weight (g/mol) | 300.15 |
| MDL Number | MFCD00039278 |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Synonym | 1h,1h,5h-octafluoropentyl methacrylate,2,2,3,3,4,4,5,5-octafluoropentyl methacrylate,octafluoropentyl methacrylate,1h,1h,5h-perfluoropentyl methacrylate,1h,1h,5h-octafluoropentyl methacrylate stabilized with mehq,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5-octafluoropentyl ester,methacrylic acid 1h,1h,5h-perfluoropentyl ester,methacrylic acid 1h,1h,5h-octafluoropentyl ester,octafluoropentyl methacrylate polymer,1h,1h,5h-octafluoropentylmethacrylate |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-methylprop-2-enoate |
| InChI Key | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| Molecular Formula | C9H8F8O2 |
Propyl Gallate, NF, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 121-79-9 Molecular Weight (g/mol): 212.2 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(O)=C(O)C(O)=C1
| CAS | 121-79-9 |
|---|---|
| Molecular Weight (g/mol) | 212.2 |
| SMILES | CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
Tamoxifen Citrate, USP, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N IUPAC Name: (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| CAS | 54965-24-1 |
|---|---|
| Molecular Weight (g/mol) | 563.65 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| IUPAC Name | (2-{4-[(1Z)-1,2-diphenylbut-1-en-1-yl]phenoxy}ethyl)dimethylamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
MilliporeSigma™ BAPTA, Tetra sodium Salt, Calbiochem™,
CAS: 126824-24-6 Molecular Formula: C22H20N2Na4O10 Molecular Weight (g/mol): 564.37 MDL Number: MFCD02683087 InChI Key: ZWSMLJACYSGFKD-UHFFFAOYSA-J Synonym: bapta-na4,bapta tetrasodium,bapta tetrasodium salt,sodium 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,bapta, tetrasodium salt,bapta tetrasodium salt hydrate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt,tetrasodium 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,1,2-bis 2-aminophenoxy-ethane-n,n,n, n-tetraacetic acid tetrasodium salt,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt hplc PubChem CID: 2734965 IUPAC Name: tetrasodium 2-{[2-(2-{2-[bis(carboxylatomethyl)amino]phenoxy}ethoxy)phenyl](carboxylatomethyl)amino}acetate SMILES: [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC([O-])=O)CC([O-])=O
| PubChem CID | 2734965 |
|---|---|
| CAS | 126824-24-6 |
| Molecular Weight (g/mol) | 564.37 |
| MDL Number | MFCD02683087 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC([O-])=O)CC([O-])=O |
| Synonym | bapta-na4,bapta tetrasodium,bapta tetrasodium salt,sodium 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,bapta, tetrasodium salt,bapta tetrasodium salt hydrate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt,tetrasodium 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,1,2-bis 2-aminophenoxy-ethane-n,n,n, n-tetraacetic acid tetrasodium salt,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetrasodium salt hplc |
| IUPAC Name | tetrasodium 2-{[2-(2-{2-[bis(carboxylatomethyl)amino]phenoxy}ethoxy)phenyl](carboxylatomethyl)amino}acetate |
| InChI Key | ZWSMLJACYSGFKD-UHFFFAOYSA-J |
| Molecular Formula | C22H20N2Na4O10 |
Thioglycolic Acid Solution, ∼80 in Water, MilliporeSigma™ Supelco™
MDL Number: MFCD00004876 Synonym: Mercaptoacetic acid
| MDL Number | MFCD00004876 |
|---|---|
| Synonym | Mercaptoacetic acid |
Thermo Scientific Chemicals N-Isopropylacrylamide, 99%, pure, stabilized
CAS: 2210-25-5 Molecular Formula: C6H11NO Molecular Weight (g/mol): 113.16 MDL Number: MFCD00041913 InChI Key: QNILTEGFHQSKFF-UHFFFAOYSA-N Synonym: n-isopropylacrylamide,nipam,n-iso-propylacrylamide,2-propenamide, n-1-methylethyl,isopropyl acrylamide,acrylamide, n-isopropyl,n-isopropyl acrylamide,n-1-methylethyl-2-propenamide,isopropylamid kyseliny akrylove,unii-b7gff17l9u PubChem CID: 16637 IUPAC Name: N-propan-2-ylprop-2-enamide SMILES: CC(C)NC(=O)C=C
| PubChem CID | 16637 |
|---|---|
| CAS | 2210-25-5 |
| Molecular Weight (g/mol) | 113.16 |
| MDL Number | MFCD00041913 |
| SMILES | CC(C)NC(=O)C=C |
| Synonym | n-isopropylacrylamide,nipam,n-iso-propylacrylamide,2-propenamide, n-1-methylethyl,isopropyl acrylamide,acrylamide, n-isopropyl,n-isopropyl acrylamide,n-1-methylethyl-2-propenamide,isopropylamid kyseliny akrylove,unii-b7gff17l9u |
| IUPAC Name | N-propan-2-ylprop-2-enamide |
| InChI Key | QNILTEGFHQSKFF-UHFFFAOYSA-N |
| Molecular Formula | C6H11NO |